About 3-ethyl-3-methoxyoxetane
3-ethyl-3-methoxyoxetane (PubChem CID 22277879) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 3-ethyl-3-methoxyoxetane.
Molecular Properties
| Compound Name | 3-ethyl-3-methoxyoxetane |
| PubChem CID | 22277879 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 3-ethyl-3-methoxyoxetane |
| SMILES | CCC1(OC)COC1 |
| InChI | InChI=1S/C6H12O2/c1-3-6(7-2)4-8-5-6/h3-5H2,1-2H3 |
| InChIKey | WHYSCQXYFSXDDS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-3-methoxyoxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-methoxyoxetane?
The IUPAC name of 3-ethyl-3-methoxyoxetane (CID 22277879) is 3-ethyl-3-methoxyoxetane.
What is the SMILES notation for 3-ethyl-3-methoxyoxetane?
The canonical SMILES for 3-ethyl-3-methoxyoxetane is CCC1(OC)COC1.
What is the InChIKey of 3-ethyl-3-methoxyoxetane?
The InChIKey is WHYSCQXYFSXDDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-3-6(7-2)4-8-5-6/h3-5H2,1-2H3.
What are the key properties of 3-ethyl-3-methoxyoxetane?
3-ethyl-3-methoxyoxetane has a molecular weight of 116.16 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-methoxyoxetane is sourced from PubChem (CID 22277879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).