About 3,4-dimethylbenzaldehyde
3,4-dimethylbenzaldehyde (PubChem CID 22278) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 3,4-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 3,4-dimethylbenzaldehyde |
| PubChem CID | 22278 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 3,4-dimethylbenzaldehyde |
| SMILES | Cc1ccc(C=O)cc1C |
| InChI | InChI=1S/C9H10O/c1-7-3-4-9(6-10)5-8(7)2/h3-6H,1-2H3 |
| InChIKey | POQJHLBMLVTHAU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylbenzaldehyde?
The IUPAC name of 3,4-dimethylbenzaldehyde (CID 22278) is 3,4-dimethylbenzaldehyde.
What is the SMILES notation for 3,4-dimethylbenzaldehyde?
The canonical SMILES for 3,4-dimethylbenzaldehyde is Cc1ccc(C=O)cc1C.
What is the InChIKey of 3,4-dimethylbenzaldehyde?
The InChIKey is POQJHLBMLVTHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-7-3-4-9(6-10)5-8(7)2/h3-6H,1-2H3.
What are the key properties of 3,4-dimethylbenzaldehyde?
3,4-dimethylbenzaldehyde has a molecular weight of 134.18 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylbenzaldehyde is sourced from PubChem (CID 22278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).