C15H18F6O3 — CID 22278100
[2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate (PubChem CID 22278100) has the molecular formula C15H18F6O3 and a molecular weight of 360.29 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate.
| Compound Name | [2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 22278100 |
| Molecular Formula | C15H18F6O3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropan-2-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC(C1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H18F6O3/c1-12(2,3)23-11(22)24-13(14(16,17)18,15(19,20)21)10-7-8-4-5-9(10)6-8/h4-5,8-10H,6-7H2,1-3H3 |
| InChIKey | QEMNFPDUBFNNTD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|