C15H16N4O4 — CID 22278584
2-[(5-amino-1H-pyrazole-4-carbonyl)amino]-2-(3-prop-2-enoxyphenyl)acetic acid (PubChem CID 22278584) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 2-[(5-amino-1H-pyrazole-4-carbonyl)amino]-2-(3-prop-2-enoxyphenyl)acetic acid.
| Compound Name | 2-[(5-amino-1H-pyrazole-4-carbonyl)amino]-2-(3-prop-2-enoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 22278584 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[(5-amino-1H-pyrazole-4-carbonyl)amino]-2-(3-prop-2-enoxyphenyl)acetic acid |
| SMILES | C=CCOc1cccc(C(NC(=O)c2cn[nH]c2N)C(=O)O)c1 |
| InChI | InChI=1S/C15H16N4O4/c1-2-6-23-10-5-3-4-9(7-10)12(15(21)22)18-14(20)11-8-17-19-13(11)16/h2-5,7-8,12H,1,6H2,(H,18,20)(H,21,22)(H3,16,17,19) |
| InChIKey | MQSXGYPHDMSMKB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|