C25H36N4O2S — CID 22278763
2-[[5-[3,6-diethyl-5-(pentan-3-ylamino)pyrazin-2-yl]-6-methoxy-2,3-dihydro-1H-inden-1-yl]oxy]ethanethioamide (PubChem CID 22278763) has the molecular formula C25H36N4O2S and a molecular weight of 456.66 g/mol. Its IUPAC name is 2-[[5-[3,6-diethyl-5-(pentan-3-ylamino)pyrazin-2-yl]-6-methoxy-2,3-dihydro-1H-inden-1-yl]oxy]ethanethioamide.
| Compound Name | 2-[[5-[3,6-diethyl-5-(pentan-3-ylamino)pyrazin-2-yl]-6-methoxy-2,3-dihydro-1H-inden-1-yl]oxy]ethanethioamide |
|---|---|
| PubChem CID | 22278763 |
| Molecular Formula | C25H36N4O2S |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-[[5-[3,6-diethyl-5-(pentan-3-ylamino)pyrazin-2-yl]-6-methoxy-2,3-dihydro-1H-inden-1-yl]oxy]ethanethioamide |
| SMILES | CCc1nc(-c2cc3c(cc2OC)C(OCC(N)=S)CC3)c(CC)nc1NC(CC)CC |
| InChI | InChI=1S/C25H36N4O2S/c1-6-16(7-2)27-25-20(9-4)28-24(19(8-3)29-25)18-12-15-10-11-21(31-14-23(26)32)17(15)13-22(18)30-5/h12-13,16,21H,6-11,14H2,1-5H3,(H2,26,32)(H,27,29) |
| InChIKey | FDODGSVGSLVVQS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|