C13H8F8N2O — CID 22278979
7-(2,2,3,3,3-pentafluoropropylamino)-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 22278979) has the molecular formula C13H8F8N2O and a molecular weight of 360.20 g/mol. Its IUPAC name is 7-(2,2,3,3,3-pentafluoropropylamino)-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 7-(2,2,3,3,3-pentafluoropropylamino)-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22278979 |
| Molecular Formula | C13H8F8N2O |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 7-(2,2,3,3,3-pentafluoropropylamino)-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2ccc(NCC(F)(F)C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C13H8F8N2O/c14-11(15,13(19,20)21)5-22-6-1-2-7-8(12(16,17)18)4-10(24)23-9(7)3-6/h1-4,22H,5H2,(H,23,24) |
| InChIKey | CCLXBKICDYKGFF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|