C15H14F6N2O — CID 22279076
6-[bis(2,2,2-trifluoroethyl)amino]-4-ethyl-1H-quinolin-2-one (PubChem CID 22279076) has the molecular formula C15H14F6N2O and a molecular weight of 352.28 g/mol. Its IUPAC name is 6-[bis(2,2,2-trifluoroethyl)amino]-4-ethyl-1H-quinolin-2-one.
| Compound Name | 6-[bis(2,2,2-trifluoroethyl)amino]-4-ethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22279076 |
| Molecular Formula | C15H14F6N2O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 6-[bis(2,2,2-trifluoroethyl)amino]-4-ethyl-1H-quinolin-2-one |
| SMILES | CCc1cc(=O)[nH]c2ccc(N(CC(F)(F)F)CC(F)(F)F)cc12 |
| InChI | InChI=1S/C15H14F6N2O/c1-2-9-5-13(24)22-12-4-3-10(6-11(9)12)23(7-14(16,17)18)8-15(19,20)21/h3-6H,2,7-8H2,1H3,(H,22,24) |
| InChIKey | VEVDGOPJKLREFE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |