C16H16F6N2O — CID 22279178
6-[bis(2,2,2-trifluoroethyl)amino]-4-propan-2-yl-1H-quinolin-2-one (PubChem CID 22279178) has the molecular formula C16H16F6N2O and a molecular weight of 366.31 g/mol. Its IUPAC name is 6-[bis(2,2,2-trifluoroethyl)amino]-4-propan-2-yl-1H-quinolin-2-one.
| Compound Name | 6-[bis(2,2,2-trifluoroethyl)amino]-4-propan-2-yl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22279178 |
| Molecular Formula | C16H16F6N2O |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 6-[bis(2,2,2-trifluoroethyl)amino]-4-propan-2-yl-1H-quinolin-2-one |
| SMILES | CC(C)c1cc(=O)[nH]c2ccc(N(CC(F)(F)F)CC(F)(F)F)cc12 |
| InChI | InChI=1S/C16H16F6N2O/c1-9(2)11-6-14(25)23-13-4-3-10(5-12(11)13)24(7-15(17,18)19)8-16(20,21)22/h3-6,9H,7-8H2,1-2H3,(H,23,25) |
| InChIKey | VXYMFUUOLVWDBC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |