About 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine
6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine (PubChem CID 22279339) has the molecular formula C17H32N2O
and a molecular weight of 280.46 g/mol. Its IUPAC name is 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine.
Molecular Properties
| Compound Name | 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine |
| PubChem CID | 22279339 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine |
| SMILES | C=CCN(CC=C)CCCCCCOC1CCNCC1 |
| InChI | InChI=1S/C17H32N2O/c1-3-13-19(14-4-2)15-7-5-6-8-16-20-17-9-11-18-12-10-17/h3-4,17-18H,1-2,5-16H2 |
| InChIKey | KXRKLXMVRKOVCX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine?
The IUPAC name of 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine (CID 22279339) is 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine.
What is the SMILES notation for 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine?
The canonical SMILES for 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine is C=CCN(CC=C)CCCCCCOC1CCNCC1.
What is the InChIKey of 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine?
The InChIKey is KXRKLXMVRKOVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2O/c1-3-13-19(14-4-2)15-7-5-6-8-16-20-17-9-11-18-12-10-17/h3-4,17-18H,1-2,5-16H2.
What are the key properties of 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine?
6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine has a molecular weight of 280.46 g/mol, XLogP of 2.99, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperidin-4-yloxy-N,N-bis(prop-2-enyl)hexan-1-amine is sourced from PubChem (CID 22279339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).