About 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate
1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate (PubChem CID 22279531) has the molecular formula C19H17FN2O3
and a molecular weight of 340.35 g/mol. Its IUPAC name is 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate |
| PubChem CID | 22279531 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate |
| SMILES | Cc1onc(-c2ccccc2)c1NC(=O)OC(C)c1ccccc1F |
| InChI | InChI=1S/C19H17FN2O3/c1-12(15-10-6-7-11-16(15)20)24-19(23)21-17-13(2)25-22-18(17)14-8-4-3-5-9-14/h3-12H,1-2H3,(H,21,23) |
| InChIKey | MMGZQQCAXKODSG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate?
The IUPAC name of 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate (CID 22279531) is 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate.
What is the SMILES notation for 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate?
The canonical SMILES for 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate is Cc1onc(-c2ccccc2)c1NC(=O)OC(C)c1ccccc1F.
What is the InChIKey of 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate?
The InChIKey is MMGZQQCAXKODSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O3/c1-12(15-10-6-7-11-16(15)20)24-19(23)21-17-13(2)25-22-18(17)14-8-4-3-5-9-14/h3-12H,1-2H3,(H,21,23).
What are the key properties of 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate?
1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate has a molecular weight of 340.35 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)ethyl N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)carbamate is sourced from PubChem (CID 22279531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).