About 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate
1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 22279578) has the molecular formula C19H16F2N2O3
and a molecular weight of 358.34 g/mol. Its IUPAC name is 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate |
| PubChem CID | 22279578 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(-c2cccc(F)c2)c1NC(=O)OC(C)c1ccccc1F |
| InChI | InChI=1S/C19H16F2N2O3/c1-11-17(18(26-23-11)13-6-5-7-14(20)10-13)22-19(24)25-12(2)15-8-3-4-9-16(15)21/h3-10,12H,1-2H3,(H,22,24) |
| InChIKey | ACURDQSOPLTWBS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate?
The IUPAC name of 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate (CID 22279578) is 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate.
What is the SMILES notation for 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate?
The canonical SMILES for 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate is Cc1noc(-c2cccc(F)c2)c1NC(=O)OC(C)c1ccccc1F.
What is the InChIKey of 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate?
The InChIKey is ACURDQSOPLTWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N2O3/c1-11-17(18(26-23-11)13-6-5-7-14(20)10-13)22-19(24)25-12(2)15-8-3-4-9-16(15)21/h3-10,12H,1-2H3,(H,22,24).
What are the key properties of 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate?
1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate has a molecular weight of 358.34 g/mol, XLogP of 5.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)ethyl N-[5-(3-fluorophenyl)-3-methyl-1,2-oxazol-4-yl]carbamate is sourced from PubChem (CID 22279578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).