C20H22F3NOS — CID 22279822
2-amino-2-methyl-4-[5-[5-(2,3,4-trifluorophenyl)pent-1-ynyl]thiophen-2-yl]butan-1-ol (PubChem CID 22279822) has the molecular formula C20H22F3NOS and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[5-[5-(2,3,4-trifluorophenyl)pent-1-ynyl]thiophen-2-yl]butan-1-ol.
| Compound Name | 2-amino-2-methyl-4-[5-[5-(2,3,4-trifluorophenyl)pent-1-ynyl]thiophen-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 22279822 |
| Molecular Formula | C20H22F3NOS |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-amino-2-methyl-4-[5-[5-(2,3,4-trifluorophenyl)pent-1-ynyl]thiophen-2-yl]butan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(C#CCCCc2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C20H22F3NOS/c1-20(24,13-25)12-11-16-9-8-15(26-16)6-4-2-3-5-14-7-10-17(21)19(23)18(14)22/h7-10,25H,2-3,5,11-13,24H2,1H3 |
| InChIKey | SLHHKPSRFBCAQB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|