About 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol
2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol (PubChem CID 22279882) has the molecular formula C19H21F2NO2S
and a molecular weight of 365.45 g/mol. Its IUPAC name is 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol.
Molecular Properties
| Compound Name | 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol |
| PubChem CID | 22279882 |
| Molecular Formula | C19H21F2NO2S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(C#CCCOc2cc(F)cc(F)c2)s1 |
| InChI | InChI=1S/C19H21F2NO2S/c1-19(22,13-23)8-7-18-6-5-17(25-18)4-2-3-9-24-16-11-14(20)10-15(21)12-16/h5-6,10-12,23H,3,7-9,13,22H2,1H3 |
| InChIKey | CMOYACGHXOAZHK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol?
The IUPAC name of 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol (CID 22279882) is 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol.
What is the SMILES notation for 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol?
The canonical SMILES for 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol is CC(N)(CO)CCc1ccc(C#CCCOc2cc(F)cc(F)c2)s1.
What is the InChIKey of 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol?
The InChIKey is CMOYACGHXOAZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2NO2S/c1-19(22,13-23)8-7-18-6-5-17(25-18)4-2-3-9-24-16-11-14(20)10-15(21)12-16/h5-6,10-12,23H,3,7-9,13,22H2,1H3.
What are the key properties of 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol?
2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol has a molecular weight of 365.45 g/mol, XLogP of 3.49, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[5-[4-(3,5-difluorophenoxy)but-1-ynyl]thiophen-2-yl]-2-methylbutan-1-ol is sourced from PubChem (CID 22279882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).