C10H8ClNO3S — CID 22280060
2-(5-chloro-2-methyl-4-thiocyanatophenoxy)acetic acid (PubChem CID 22280060) has the molecular formula C10H8ClNO3S and a molecular weight of 257.70 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-4-thiocyanatophenoxy)acetic acid.
| Compound Name | 2-(5-chloro-2-methyl-4-thiocyanatophenoxy)acetic acid |
|---|---|
| PubChem CID | 22280060 |
| Molecular Formula | C10H8ClNO3S |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2-(5-chloro-2-methyl-4-thiocyanatophenoxy)acetic acid |
| SMILES | Cc1cc(SC#N)c(Cl)cc1OCC(=O)O |
| InChI | InChI=1S/C10H8ClNO3S/c1-6-2-9(16-5-12)7(11)3-8(6)15-4-10(13)14/h2-3H,4H2,1H3,(H,13,14) |
| InChIKey | VKMCNGFWVTTXGO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|