About 4-(2,3,5,6-tetraethynylphenyl)pyridine
4-(2,3,5,6-tetraethynylphenyl)pyridine (PubChem CID 22280335) has the molecular formula C19H9N
and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-(2,3,5,6-tetraethynylphenyl)pyridine.
Molecular Properties
| Compound Name | 4-(2,3,5,6-tetraethynylphenyl)pyridine |
| PubChem CID | 22280335 |
| Molecular Formula | C19H9N |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4-(2,3,5,6-tetraethynylphenyl)pyridine |
| SMILES | C#Cc1cc(C#C)c(C#C)c(-c2ccncc2)c1C#C |
| InChI | InChI=1S/C19H9N/c1-5-14-13-15(6-2)18(8-4)19(17(14)7-3)16-9-11-20-12-10-16/h1-4,9-13H |
| InChIKey | FIKKKWRESVWGAQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3,5,6-tetraethynylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3,5,6-tetraethynylphenyl)pyridine?
The IUPAC name of 4-(2,3,5,6-tetraethynylphenyl)pyridine (CID 22280335) is 4-(2,3,5,6-tetraethynylphenyl)pyridine.
What is the SMILES notation for 4-(2,3,5,6-tetraethynylphenyl)pyridine?
The canonical SMILES for 4-(2,3,5,6-tetraethynylphenyl)pyridine is C#Cc1cc(C#C)c(C#C)c(-c2ccncc2)c1C#C.
What is the InChIKey of 4-(2,3,5,6-tetraethynylphenyl)pyridine?
The InChIKey is FIKKKWRESVWGAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H9N/c1-5-14-13-15(6-2)18(8-4)19(17(14)7-3)16-9-11-20-12-10-16/h1-4,9-13H.
What are the key properties of 4-(2,3,5,6-tetraethynylphenyl)pyridine?
4-(2,3,5,6-tetraethynylphenyl)pyridine has a molecular weight of 251.29 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3,5,6-tetraethynylphenyl)pyridine is sourced from PubChem (CID 22280335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).