About CID 22280345
CID 22280345 (PubChem CID 22280345) has the molecular formula C14H28O7PSi
and a molecular weight of 367.43 g/mol.
Molecular Properties
| Compound Name | CID 22280345 |
| PubChem CID | 22280345 |
| Molecular Formula | C14H28O7PSi |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | — |
| SMILES | COP(=O)(CC(=O)CC(CC(=O)OO[Si](C)C)C(C)(C)C)OC |
| InChI | InChI=1S/C14H28O7PSi/c1-14(2,3)11(9-13(16)20-21-23(6)7)8-12(15)10-22(17,18-4)19-5/h11H,8-10H2,1-7H3 |
| InChIKey | QBPHBXSCMXIQMG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 22280345 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22280345?
The IUPAC name of CID 22280345 (CID 22280345) is not available.
What is the SMILES notation for CID 22280345?
The canonical SMILES for CID 22280345 is COP(=O)(CC(=O)CC(CC(=O)OO[Si](C)C)C(C)(C)C)OC.
What is the InChIKey of CID 22280345?
The InChIKey is QBPHBXSCMXIQMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O7PSi/c1-14(2,3)11(9-13(16)20-21-23(6)7)8-12(15)10-22(17,18-4)19-5/h11H,8-10H2,1-7H3.
What are the key properties of CID 22280345?
CID 22280345 has a molecular weight of 367.43 g/mol, XLogP of 3.21, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22280345 is sourced from PubChem (CID 22280345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).