About 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide
2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide (PubChem CID 22280413) has the molecular formula C11H19N2O4PS
and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 22280413 |
| Molecular Formula | C11H19N2O4PS |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCOP(=O)(CC(=O)Nc1nc(C)c(C)s1)OCC |
| InChI | InChI=1S/C11H19N2O4PS/c1-5-16-18(15,17-6-2)7-10(14)13-11-12-8(3)9(4)19-11/h5-7H2,1-4H3,(H,12,13,14) |
| InChIKey | YYTFHLQGRFFDDA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide (CID 22280413) is 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide is CCOP(=O)(CC(=O)Nc1nc(C)c(C)s1)OCC.
What is the InChIKey of 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is YYTFHLQGRFFDDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N2O4PS/c1-5-16-18(15,17-6-2)7-10(14)13-11-12-8(3)9(4)19-11/h5-7H2,1-4H3,(H,12,13,14).
What are the key properties of 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide?
2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 306.32 g/mol, XLogP of 2.96, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethoxyphosphoryl-N-(4,5-dimethyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 22280413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).