About [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid
[2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid (PubChem CID 22280435) has the molecular formula C13H19N2O4P
and a molecular weight of 298.28 g/mol. Its IUPAC name is [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid.
Molecular Properties
| Compound Name | [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid |
| PubChem CID | 22280435 |
| Molecular Formula | C13H19N2O4P |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid |
| SMILES | Cc1nc(-c2occc2P(=O)(O)O)n(CC(C)C)c1C |
| InChI | InChI=1S/C13H19N2O4P/c1-8(2)7-15-10(4)9(3)14-13(15)12-11(5-6-19-12)20(16,17)18/h5-6,8H,7H2,1-4H3,(H2,16,17,18) |
| InChIKey | YSVJAJHAUMEJOD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid?
The IUPAC name of [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid (CID 22280435) is [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid.
What is the SMILES notation for [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid?
The canonical SMILES for [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid is Cc1nc(-c2occc2P(=O)(O)O)n(CC(C)C)c1C.
What is the InChIKey of [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid?
The InChIKey is YSVJAJHAUMEJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N2O4P/c1-8(2)7-15-10(4)9(3)14-13(15)12-11(5-6-19-12)20(16,17)18/h5-6,8H,7H2,1-4H3,(H2,16,17,18).
What are the key properties of [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid?
[2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid has a molecular weight of 298.28 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4,5-dimethyl-1-(2-methylpropyl)imidazol-2-yl]furan-3-yl]phosphonic acid is sourced from PubChem (CID 22280435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).