C7H11N2O4PS — CID 22280618
[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]phosphonic acid (PubChem CID 22280618) has the molecular formula C7H11N2O4PS and a molecular weight of 250.22 g/mol. Its IUPAC name is [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 22280618 |
| Molecular Formula | C7H11N2O4PS |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | [2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]phosphonic acid |
| SMILES | Cc1nc(NC(=O)CP(=O)(O)O)sc1C |
| InChI | InChI=1S/C7H11N2O4PS/c1-4-5(2)15-7(8-4)9-6(10)3-14(11,12)13/h3H2,1-2H3,(H,8,9,10)(H2,11,12,13) |
| InChIKey | LBOMKXMMHXZPTE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|