About (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid
(2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid (PubChem CID 22280622) has the molecular formula C5H7N2O6P
and a molecular weight of 222.09 g/mol. Its IUPAC name is (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid.
Molecular Properties
| Compound Name | (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid |
| PubChem CID | 22280622 |
| Molecular Formula | C5H7N2O6P |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid |
| SMILES | Nc1nc(C(=O)OCP(=O)(O)O)co1 |
| InChI | InChI=1S/C5H7N2O6P/c6-5-7-3(1-12-5)4(8)13-2-14(9,10)11/h1H,2H2,(H2,6,7)(H2,9,10,11) |
| InChIKey | HYWMTSVUDQKOAZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid?
The IUPAC name of (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid (CID 22280622) is (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid.
What is the SMILES notation for (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid?
The canonical SMILES for (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid is Nc1nc(C(=O)OCP(=O)(O)O)co1.
What is the InChIKey of (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid?
The InChIKey is HYWMTSVUDQKOAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N2O6P/c6-5-7-3(1-12-5)4(8)13-2-14(9,10)11/h1H,2H2,(H2,6,7)(H2,9,10,11).
What are the key properties of (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid?
(2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid has a molecular weight of 222.09 g/mol, XLogP of -0.45, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-oxazole-4-carbonyl)oxymethylphosphonic acid is sourced from PubChem (CID 22280622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).