About silver;ethylsulfanylethane;nitrate
silver;ethylsulfanylethane;nitrate (PubChem CID 22280837) has the molecular formula C4H10AgNO3S
and a molecular weight of 260.06 g/mol. Its IUPAC name is silver;ethylsulfanylethane;nitrate.
Molecular Properties
| Compound Name | silver;ethylsulfanylethane;nitrate |
| PubChem CID | 22280837 |
| Molecular Formula | C4H10AgNO3S |
| Molecular Weight | 260.06 g/mol |
| Exact Mass | 258.94 |
| IUPAC Name | silver;ethylsulfanylethane;nitrate |
| SMILES | CCSCC.O=[N+]([O-])[O-].[Ag+] |
| InChI | InChI=1S/C4H10S.Ag.NO3/c1-3-5-4-2;;2-1(3)4/h3-4H2,1-2H3;;/q;+1;-1 |
| InChIKey | LPWPYJMTOBDGMX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.06 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze silver;ethylsulfanylethane;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;ethylsulfanylethane;nitrate?
The IUPAC name of silver;ethylsulfanylethane;nitrate (CID 22280837) is silver;ethylsulfanylethane;nitrate.
What is the SMILES notation for silver;ethylsulfanylethane;nitrate?
The canonical SMILES for silver;ethylsulfanylethane;nitrate is CCSCC.O=[N+]([O-])[O-].[Ag+].
What is the InChIKey of silver;ethylsulfanylethane;nitrate?
The InChIKey is LPWPYJMTOBDGMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10S.Ag.NO3/c1-3-5-4-2;;2-1(3)4/h3-4H2,1-2H3;;/q;+1;-1.
What are the key properties of silver;ethylsulfanylethane;nitrate?
silver;ethylsulfanylethane;nitrate has a molecular weight of 260.06 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver;ethylsulfanylethane;nitrate is sourced from PubChem (CID 22280837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).