C15H28N2O5 — CID 22280845
[4-[3-[3-hydroxypropyl(methyl)amino]-3-oxopropoxy]cyclohexyl]-methylcarbamic acid (PubChem CID 22280845) has the molecular formula C15H28N2O5 and a molecular weight of 316.40 g/mol. Its IUPAC name is [4-[3-[3-hydroxypropyl(methyl)amino]-3-oxopropoxy]cyclohexyl]-methylcarbamic acid.
| Compound Name | [4-[3-[3-hydroxypropyl(methyl)amino]-3-oxopropoxy]cyclohexyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 22280845 |
| Molecular Formula | C15H28N2O5 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | [4-[3-[3-hydroxypropyl(methyl)amino]-3-oxopropoxy]cyclohexyl]-methylcarbamic acid |
| SMILES | CN(CCCO)C(=O)CCOC1CCC(N(C)C(=O)O)CC1 |
| InChI | InChI=1S/C15H28N2O5/c1-16(9-3-10-18)14(19)8-11-22-13-6-4-12(5-7-13)17(2)15(20)21/h12-13,18H,3-11H2,1-2H3,(H,20,21) |
| InChIKey | MCICCCPNXQWKIR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |