C15H20F6O2 — CID 22281044
5-[2-(1-ethoxyethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 22281044) has the molecular formula C15H20F6O2 and a molecular weight of 346.31 g/mol. Its IUPAC name is 5-[2-(1-ethoxyethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[2-(1-ethoxyethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 22281044 |
| Molecular Formula | C15H20F6O2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 5-[2-(1-ethoxyethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | CCOC(C)OC(CC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H20F6O2/c1-3-22-9(2)23-13(14(16,17)18,15(19,20)21)8-12-7-10-4-5-11(12)6-10/h4-5,9-12H,3,6-8H2,1-2H3 |
| InChIKey | APHYGKDJBGBWFL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|