About 2-acetylpentanenitrile
2-acetylpentanenitrile (PubChem CID 22281314) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-acetylpentanenitrile.
Molecular Properties
| Compound Name | 2-acetylpentanenitrile |
| PubChem CID | 22281314 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 2-acetylpentanenitrile |
| SMILES | CCCC(C#N)C(C)=O |
| InChI | InChI=1S/C7H11NO/c1-3-4-7(5-8)6(2)9/h7H,3-4H2,1-2H3 |
| InChIKey | HDBFGYFHJXUVFB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|
Analyze 2-acetylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetylpentanenitrile?
The IUPAC name of 2-acetylpentanenitrile (CID 22281314) is 2-acetylpentanenitrile.
What is the SMILES notation for 2-acetylpentanenitrile?
The canonical SMILES for 2-acetylpentanenitrile is CCCC(C#N)C(C)=O.
What is the InChIKey of 2-acetylpentanenitrile?
The InChIKey is HDBFGYFHJXUVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-3-4-7(5-8)6(2)9/h7H,3-4H2,1-2H3.
What are the key properties of 2-acetylpentanenitrile?
2-acetylpentanenitrile has a molecular weight of 125.17 g/mol, XLogP of 1.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetylpentanenitrile is sourced from PubChem (CID 22281314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).