About 2-formylbutanenitrile
2-formylbutanenitrile (PubChem CID 22281319) has the molecular formula C5H7NO
and a molecular weight of 97.12 g/mol. Its IUPAC name is 2-formylbutanenitrile.
Molecular Properties
| Compound Name | 2-formylbutanenitrile |
| PubChem CID | 22281319 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | 2-formylbutanenitrile |
| SMILES | CCC(C#N)C=O |
| InChI | InChI=1S/C5H7NO/c1-2-5(3-6)4-7/h4-5H,2H2,1H3 |
| InChIKey | CWNRYVQFAMHXLM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-formylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formylbutanenitrile?
The IUPAC name of 2-formylbutanenitrile (CID 22281319) is 2-formylbutanenitrile.
What is the SMILES notation for 2-formylbutanenitrile?
The canonical SMILES for 2-formylbutanenitrile is CCC(C#N)C=O.
What is the InChIKey of 2-formylbutanenitrile?
The InChIKey is CWNRYVQFAMHXLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO/c1-2-5(3-6)4-7/h4-5H,2H2,1H3.
What are the key properties of 2-formylbutanenitrile?
2-formylbutanenitrile has a molecular weight of 97.12 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formylbutanenitrile is sourced from PubChem (CID 22281319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).