C20H18N4O — CID 22281654
1-ethyl-3,5-diphenyl-6,7-dihydropyrazolo[4,5-e][1,4]diazepin-8-one (PubChem CID 22281654) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-ethyl-3,5-diphenyl-6,7-dihydropyrazolo[4,5-e][1,4]diazepin-8-one.
| Compound Name | 1-ethyl-3,5-diphenyl-6,7-dihydropyrazolo[4,5-e][1,4]diazepin-8-one |
|---|---|
| PubChem CID | 22281654 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-ethyl-3,5-diphenyl-6,7-dihydropyrazolo[4,5-e][1,4]diazepin-8-one |
| SMILES | CCn1nc(-c2ccccc2)c2c1C(=O)NCC(c1ccccc1)=N2 |
| InChI | InChI=1S/C20H18N4O/c1-2-24-19-18(17(23-24)15-11-7-4-8-12-15)22-16(13-21-20(19)25)14-9-5-3-6-10-14/h3-12H,2,13H2,1H3,(H,21,25) |
| InChIKey | WBLKHOURPUSIGN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |