6-methoxy-1,5-naphthyridine-4-carboxylic acid

C10H8N2O3 — CID 22281721

IUPAC6-methoxy-1,5-naphthyridine-4-carboxylic acid
SMILESCOc1ccc2nccc(C(=O)O)c2n1
InChIInChI=1S/C10H8N2O3/c1-15-8-3-2-7-9(12-8)6(10(13)14)4-5-11-7/h2-5H,1H3,(H,13,14)
InChIKeyPLMVZIBVXVPVSZ-UHFFFAOYSA-N
MW204.19 g/mol
LogP1.34
Rot. Bonds2

About 6-methoxy-1,5-naphthyridine-4-carboxylic acid

6-methoxy-1,5-naphthyridine-4-carboxylic acid (PubChem CID 22281721) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 6-methoxy-1,5-naphthyridine-4-carboxylic acid.

Molecular Properties

Compound Name6-methoxy-1,5-naphthyridine-4-carboxylic acid
PubChem CID22281721
Molecular FormulaC10H8N2O3
Molecular Weight204.19 g/mol
Exact Mass204.05
IUPAC Name6-methoxy-1,5-naphthyridine-4-carboxylic acid
SMILESCOc1ccc2nccc(C(=O)O)c2n1
InChIInChI=1S/C10H8N2O3/c1-15-8-3-2-7-9(12-8)6(10(13)14)4-5-11-7/h2-5H,1H3,(H,13,14)
InChIKeyPLMVZIBVXVPVSZ-UHFFFAOYSA-N
XLogP1.34
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 51.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-methoxy-1,5-naphthyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methoxy-1,5-naphthyridine-4-carboxylic acid?
The IUPAC name of 6-methoxy-1,5-naphthyridine-4-carboxylic acid (CID 22281721) is 6-methoxy-1,5-naphthyridine-4-carboxylic acid.
What is the SMILES notation for 6-methoxy-1,5-naphthyridine-4-carboxylic acid?
The canonical SMILES for 6-methoxy-1,5-naphthyridine-4-carboxylic acid is COc1ccc2nccc(C(=O)O)c2n1.
What is the InChIKey of 6-methoxy-1,5-naphthyridine-4-carboxylic acid?
The InChIKey is PLMVZIBVXVPVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c1-15-8-3-2-7-9(12-8)6(10(13)14)4-5-11-7/h2-5H,1H3,(H,13,14).
What are the key properties of 6-methoxy-1,5-naphthyridine-4-carboxylic acid?
6-methoxy-1,5-naphthyridine-4-carboxylic acid has a molecular weight of 204.19 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1,5-naphthyridine-4-carboxylic acid is sourced from PubChem (CID 22281721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).