About 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid
4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid (PubChem CID 22281912) has the molecular formula C15H17N3O5
and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid.
Molecular Properties
| Compound Name | 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid |
| PubChem CID | 22281912 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid |
| SMILES | Cn1nc(OCCCC(=O)O)c(-c2ccc3c(c2)OCO3)c1N |
| InChI | InChI=1S/C15H17N3O5/c1-18-14(16)13(15(17-18)21-6-2-3-12(19)20)9-4-5-10-11(7-9)23-8-22-10/h4-5,7H,2-3,6,8,16H2,1H3,(H,19,20) |
| InChIKey | JBPWROIATYJSIE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid?
The IUPAC name of 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid (CID 22281912) is 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid.
What is the SMILES notation for 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid?
The canonical SMILES for 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid is Cn1nc(OCCCC(=O)O)c(-c2ccc3c(c2)OCO3)c1N.
What is the InChIKey of 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid?
The InChIKey is JBPWROIATYJSIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O5/c1-18-14(16)13(15(17-18)21-6-2-3-12(19)20)9-4-5-10-11(7-9)23-8-22-10/h4-5,7H,2-3,6,8,16H2,1H3,(H,19,20).
What are the key properties of 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid?
4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid has a molecular weight of 319.32 g/mol, XLogP of 1.64, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-amino-4-(1,3-benzodioxol-5-yl)-1-methylpyrazol-3-yl]oxybutanoic acid is sourced from PubChem (CID 22281912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).