About 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate
2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate (PubChem CID 22281944) has the molecular formula C21H21N3O5
and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate.
Molecular Properties
| Compound Name | 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate |
| PubChem CID | 22281944 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate |
| SMILES | CC(=O)OCCOc1nn(Cc2ccccc2)c(N)c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21N3O5/c1-14(25)26-9-10-27-21-19(16-7-8-17-18(11-16)29-13-28-17)20(22)24(23-21)12-15-5-3-2-4-6-15/h2-8,11H,9-10,12-13,22H2,1H3 |
| InChIKey | HGOISZDJVBFBFY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate?
The IUPAC name of 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate (CID 22281944) is 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate.
What is the SMILES notation for 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate?
The canonical SMILES for 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate is CC(=O)OCCOc1nn(Cc2ccccc2)c(N)c1-c1ccc2c(c1)OCO2.
What is the InChIKey of 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate?
The InChIKey is HGOISZDJVBFBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O5/c1-14(25)26-9-10-27-21-19(16-7-8-17-18(11-16)29-13-28-17)20(22)24(23-21)12-15-5-3-2-4-6-15/h2-8,11H,9-10,12-13,22H2,1H3.
What are the key properties of 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate?
2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate has a molecular weight of 395.42 g/mol, XLogP of 2.85, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-amino-4-(1,3-benzodioxol-5-yl)-1-benzylpyrazol-3-yl]oxyethyl acetate is sourced from PubChem (CID 22281944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).