About methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate
methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate (PubChem CID 22282669) has the molecular formula C12H11NO2S
and a molecular weight of 233.29 g/mol. Its IUPAC name is methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate |
| PubChem CID | 22282669 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)-c1cc[nH]c1CC2 |
| InChI | InChI=1S/C12H11NO2S/c1-15-12(14)10-6-7-2-3-9-8(4-5-13-9)11(7)16-10/h4-6,13H,2-3H2,1H3 |
| InChIKey | NQTVPBHJNXTSCN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate?
The IUPAC name of methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate (CID 22282669) is methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate.
What is the SMILES notation for methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate?
The canonical SMILES for methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate is COC(=O)c1cc2c(s1)-c1cc[nH]c1CC2.
What is the InChIKey of methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate?
The InChIKey is NQTVPBHJNXTSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c1-15-12(14)10-6-7-2-3-9-8(4-5-13-9)11(7)16-10/h4-6,13H,2-3H2,1H3.
What are the key properties of methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate?
methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate has a molecular weight of 233.29 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,6-dihydro-4H-thieno[2,3-e]indole-2-carboxylate is sourced from PubChem (CID 22282669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).