About (3-phenoxyphenyl)methyl prop-2-enoate
(3-phenoxyphenyl)methyl prop-2-enoate (PubChem CID 22283435) has the molecular formula C16H14O3
and a molecular weight of 254.28 g/mol. Its IUPAC name is (3-phenoxyphenyl)methyl prop-2-enoate.
Molecular Properties
| Compound Name | (3-phenoxyphenyl)methyl prop-2-enoate |
| PubChem CID | 22283435 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (3-phenoxyphenyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C16H14O3/c1-2-16(17)18-12-13-7-6-10-15(11-13)19-14-8-4-3-5-9-14/h2-11H,1,12H2 |
| InChIKey | BXSPZNVFEYWSLZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3-phenoxyphenyl)methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenoxyphenyl)methyl prop-2-enoate?
The IUPAC name of (3-phenoxyphenyl)methyl prop-2-enoate (CID 22283435) is (3-phenoxyphenyl)methyl prop-2-enoate.
What is the SMILES notation for (3-phenoxyphenyl)methyl prop-2-enoate?
The canonical SMILES for (3-phenoxyphenyl)methyl prop-2-enoate is C=CC(=O)OCc1cccc(Oc2ccccc2)c1.
What is the InChIKey of (3-phenoxyphenyl)methyl prop-2-enoate?
The InChIKey is BXSPZNVFEYWSLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c1-2-16(17)18-12-13-7-6-10-15(11-13)19-14-8-4-3-5-9-14/h2-11H,1,12H2.
What are the key properties of (3-phenoxyphenyl)methyl prop-2-enoate?
(3-phenoxyphenyl)methyl prop-2-enoate has a molecular weight of 254.28 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenoxyphenyl)methyl prop-2-enoate is sourced from PubChem (CID 22283435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).