About 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol
2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol (PubChem CID 22283542) has the molecular formula C26H28F3NO4
and a molecular weight of 475.51 g/mol. Its IUPAC name is 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol.
Molecular Properties
| Compound Name | 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol |
| PubChem CID | 22283542 |
| Molecular Formula | C26H28F3NO4 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol |
| SMILES | CC(CC(O)C(N)CO)c1ccc(Oc2cccc(OCc3ccccc3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H28F3NO4/c1-17(12-25(32)24(30)15-31)22-11-10-21(14-23(22)26(27,28)29)34-20-9-5-8-19(13-20)33-16-18-6-3-2-4-7-18/h2-11,13-14,17,24-25,31-32H,12,15-16,30H2,1H3 |
| InChIKey | GFPIIZHRHXFQDH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol?
The IUPAC name of 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol (CID 22283542) is 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol.
What is the SMILES notation for 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol?
The canonical SMILES for 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol is CC(CC(O)C(N)CO)c1ccc(Oc2cccc(OCc3ccccc3)c2)cc1C(F)(F)F.
What is the InChIKey of 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol?
The InChIKey is GFPIIZHRHXFQDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28F3NO4/c1-17(12-25(32)24(30)15-31)22-11-10-21(14-23(22)26(27,28)29)34-20-9-5-8-19(13-20)33-16-18-6-3-2-4-7-18/h2-11,13-14,17,24-25,31-32H,12,15-16,30H2,1H3.
What are the key properties of 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol?
2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol has a molecular weight of 475.51 g/mol, XLogP of 5.25, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[4-(3-phenylmethoxyphenoxy)-2-(trifluoromethyl)phenyl]hexane-1,3-diol is sourced from PubChem (CID 22283542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).