C27H34ClNO4 — CID 22283563
2-amino-5-[4-[2-(3-phenylpropoxy)phenoxy]phenyl]hexane-1,3-diol;hydrochloride (PubChem CID 22283563) has the molecular formula C27H34ClNO4 and a molecular weight of 472.03 g/mol. Its IUPAC name is 2-amino-5-[4-[2-(3-phenylpropoxy)phenoxy]phenyl]hexane-1,3-diol;hydrochloride.
| Compound Name | 2-amino-5-[4-[2-(3-phenylpropoxy)phenoxy]phenyl]hexane-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 22283563 |
| Molecular Formula | C27H34ClNO4 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-amino-5-[4-[2-(3-phenylpropoxy)phenoxy]phenyl]hexane-1,3-diol;hydrochloride |
| SMILES | CC(CC(O)C(N)CO)c1ccc(Oc2ccccc2OCCCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C27H33NO4.ClH/c1-20(18-25(30)24(28)19-29)22-13-15-23(16-14-22)32-27-12-6-5-11-26(27)31-17-7-10-21-8-3-2-4-9-21;/h2-6,8-9,11-16,20,24-25,29-30H,7,10,17-19,28H2,1H3;1H |
| InChIKey | BGRUXRJNUFMBDE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|