C4F6O2 — CID 22283745
2-(difluoromethylidene)-4,4,5,5-tetrafluoro-1,3-dioxolane (PubChem CID 22283745) has the molecular formula C4F6O2 and a molecular weight of 194.03 g/mol. Its IUPAC name is 2-(difluoromethylidene)-4,4,5,5-tetrafluoro-1,3-dioxolane.
| Compound Name | 2-(difluoromethylidene)-4,4,5,5-tetrafluoro-1,3-dioxolane |
|---|---|
| PubChem CID | 22283745 |
| Molecular Formula | C4F6O2 |
| Molecular Weight | 194.03 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | 2-(difluoromethylidene)-4,4,5,5-tetrafluoro-1,3-dioxolane |
| SMILES | FC(F)=C1OC(F)(F)C(F)(F)O1 |
| InChI | InChI=1S/C4F6O2/c5-1(6)2-11-3(7,8)4(9,10)12-2 |
| InChIKey | FECGARFQHWWXCR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.03 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|