About 3-amino-4-oxobutanamide
3-amino-4-oxobutanamide (PubChem CID 22284063) has the molecular formula C4H8N2O2
and a molecular weight of 116.12 g/mol. Its IUPAC name is 3-amino-4-oxobutanamide.
Molecular Properties
| Compound Name | 3-amino-4-oxobutanamide |
| PubChem CID | 22284063 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 3-amino-4-oxobutanamide |
| SMILES | NC(=O)CC(N)C=O |
| InChI | InChI=1S/C4H8N2O2/c5-3(2-7)1-4(6)8/h2-3H,1,5H2,(H2,6,8) |
| InChIKey | FVRHIJPPPSYMGI-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-oxobutanamide?
The IUPAC name of 3-amino-4-oxobutanamide (CID 22284063) is 3-amino-4-oxobutanamide.
What is the SMILES notation for 3-amino-4-oxobutanamide?
The canonical SMILES for 3-amino-4-oxobutanamide is NC(=O)CC(N)C=O.
What is the InChIKey of 3-amino-4-oxobutanamide?
The InChIKey is FVRHIJPPPSYMGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2/c5-3(2-7)1-4(6)8/h2-3H,1,5H2,(H2,6,8).
What are the key properties of 3-amino-4-oxobutanamide?
3-amino-4-oxobutanamide has a molecular weight of 116.12 g/mol, XLogP of -1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-oxobutanamide is sourced from PubChem (CID 22284063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).