C16H18N2O4 — CID 22284129
2-(1-formyl-3-oxo-5-phenyl-2-propan-2-yl-2H-pyrazin-4-yl)acetic acid (PubChem CID 22284129) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(1-formyl-3-oxo-5-phenyl-2-propan-2-yl-2H-pyrazin-4-yl)acetic acid.
| Compound Name | 2-(1-formyl-3-oxo-5-phenyl-2-propan-2-yl-2H-pyrazin-4-yl)acetic acid |
|---|---|
| PubChem CID | 22284129 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(1-formyl-3-oxo-5-phenyl-2-propan-2-yl-2H-pyrazin-4-yl)acetic acid |
| SMILES | CC(C)C1C(=O)N(CC(=O)O)C(c2ccccc2)=CN1C=O |
| InChI | InChI=1S/C16H18N2O4/c1-11(2)15-16(22)18(9-14(20)21)13(8-17(15)10-19)12-6-4-3-5-7-12/h3-8,10-11,15H,9H2,1-2H3,(H,20,21) |
| InChIKey | GIUATBUHAJZKOW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|