About 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid
2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid (PubChem CID 22284288) has the molecular formula C9H13NO3S
and a molecular weight of 215.27 g/mol. Its IUPAC name is 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid |
| PubChem CID | 22284288 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid |
| SMILES | CC(C)C1SC=CN(CC(=O)O)C1=O |
| InChI | InChI=1S/C9H13NO3S/c1-6(2)8-9(13)10(3-4-14-8)5-7(11)12/h3-4,6,8H,5H2,1-2H3,(H,11,12) |
| InChIKey | BIOTZGQPCLCOMZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid?
The IUPAC name of 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid (CID 22284288) is 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid.
What is the SMILES notation for 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid?
The canonical SMILES for 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid is CC(C)C1SC=CN(CC(=O)O)C1=O.
What is the InChIKey of 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid?
The InChIKey is BIOTZGQPCLCOMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3S/c1-6(2)8-9(13)10(3-4-14-8)5-7(11)12/h3-4,6,8H,5H2,1-2H3,(H,11,12).
What are the key properties of 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid?
2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid has a molecular weight of 215.27 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-2-propan-2-yl-1,4-thiazin-4-yl)acetic acid is sourced from PubChem (CID 22284288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).