C17H20NO4- — CID 2228472
(2S)-2-[(1S,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-4-methylpentanoate (PubChem CID 2228472) has the molecular formula C17H20NO4- and a molecular weight of 302.35 g/mol. Its IUPAC name is (2S)-2-[(1S,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-4-methylpentanoate.
| Compound Name | (2S)-2-[(1S,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 2228472 |
| Molecular Formula | C17H20NO4- |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (2S)-2-[(1S,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)[O-])N1C(=O)[C@@H]2[C@@H]3C=C[C@@H]([C@H]4C[C@@H]34)[C@@H]2C1=O |
| InChI | InChI=1S/C17H21NO4/c1-7(2)5-12(17(21)22)18-15(19)13-8-3-4-9(11-6-10(8)11)14(13)16(18)20/h3-4,7-14H,5-6H2,1-2H3,(H,21,22)/p-1/t8-,9+,10+,11-,12-,13-,14+/m0/s1 |
| InChIKey | IKLHAPIXQITRCX-VTGSTKBOSA-M |
| XLogP | 0.20 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|