C33H41Cl2N5O3 — CID 22284991
N-[2-[1-(2,4-dichlorophenyl)-3-hydroxypropan-2-yl]-1,3-dioxoisoindol-5-yl]-3-methyl-N'-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)piperazine-1-carboximidamide (PubChem CID 22284991) has the molecular formula C33H41Cl2N5O3 and a molecular weight of 626.63 g/mol. Its IUPAC name is N-[2-[1-(2,4-dichlorophenyl)-3-hydroxypropan-2-yl]-1,3-dioxoisoindol-5-yl]-3-methyl-N'-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)piperazine-1-carboximidamide.
| Compound Name | N-[2-[1-(2,4-dichlorophenyl)-3-hydroxypropan-2-yl]-1,3-dioxoisoindol-5-yl]-3-methyl-N'-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 22284991 |
| Molecular Formula | C33H41Cl2N5O3 |
| Molecular Weight | 626.63 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | N-[2-[1-(2,4-dichlorophenyl)-3-hydroxypropan-2-yl]-1,3-dioxoisoindol-5-yl]-3-methyl-N'-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)piperazine-1-carboximidamide |
| SMILES | CC1CN(/C(=N\C2CC3CC(C2C)C3(C)C)Nc2ccc3c(c2)C(=O)N(C(CO)Cc2ccc(Cl)cc2Cl)C3=O)CCN1 |
| InChI | InChI=1S/C33H41Cl2N5O3/c1-18-16-39(10-9-36-18)32(38-29-13-21-12-27(19(29)2)33(21,3)4)37-23-7-8-25-26(15-23)31(43)40(30(25)42)24(17-41)11-20-5-6-22(34)14-28(20)35/h5-8,14-15,18-19,21,24,27,29,36,41H,9-13,16-17H2,1-4H3,(H,37,38) |
| InChIKey | OSEGLHGGGCCPAB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.63 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|