C27H29Cl2N3O2S — CID 22285013
1-[2-[2-(2,4-dichlorophenyl)ethyl]-1,3-dioxoisoindol-5-yl]-3-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)thiourea (PubChem CID 22285013) has the molecular formula C27H29Cl2N3O2S and a molecular weight of 530.52 g/mol. Its IUPAC name is 1-[2-[2-(2,4-dichlorophenyl)ethyl]-1,3-dioxoisoindol-5-yl]-3-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)thiourea.
| Compound Name | 1-[2-[2-(2,4-dichlorophenyl)ethyl]-1,3-dioxoisoindol-5-yl]-3-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)thiourea |
|---|---|
| PubChem CID | 22285013 |
| Molecular Formula | C27H29Cl2N3O2S |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1-[2-[2-(2,4-dichlorophenyl)ethyl]-1,3-dioxoisoindol-5-yl]-3-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)thiourea |
| SMILES | CC1C(NC(=S)Nc2ccc3c(c2)C(=O)N(CCc2ccc(Cl)cc2Cl)C3=O)CC2CC1C2(C)C |
| InChI | InChI=1S/C27H29Cl2N3O2S/c1-14-21-10-16(27(21,2)3)11-23(14)31-26(35)30-18-6-7-19-20(13-18)25(34)32(24(19)33)9-8-15-4-5-17(28)12-22(15)29/h4-7,12-14,16,21,23H,8-11H2,1-3H3,(H2,30,31,35) |
| InChIKey | VOXLDJZCMIIZDP-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|