About 1-aminobutane-1-thiol
1-aminobutane-1-thiol (PubChem CID 22286776) has the molecular formula C4H11NS
and a molecular weight of 105.21 g/mol. Its IUPAC name is 1-aminobutane-1-thiol.
Molecular Properties
| Compound Name | 1-aminobutane-1-thiol |
| PubChem CID | 22286776 |
| Molecular Formula | C4H11NS |
| Molecular Weight | 105.21 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 1-aminobutane-1-thiol |
| SMILES | CCCC(N)S |
| InChI | InChI=1S/C4H11NS/c1-2-3-4(5)6/h4,6H,2-3,5H2,1H3 |
| InChIKey | UODGHRYECKYJEB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminobutane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminobutane-1-thiol?
The IUPAC name of 1-aminobutane-1-thiol (CID 22286776) is 1-aminobutane-1-thiol.
What is the SMILES notation for 1-aminobutane-1-thiol?
The canonical SMILES for 1-aminobutane-1-thiol is CCCC(N)S.
What is the InChIKey of 1-aminobutane-1-thiol?
The InChIKey is UODGHRYECKYJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NS/c1-2-3-4(5)6/h4,6H,2-3,5H2,1H3.
What are the key properties of 1-aminobutane-1-thiol?
1-aminobutane-1-thiol has a molecular weight of 105.21 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminobutane-1-thiol is sourced from PubChem (CID 22286776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).