About 1-methylpyrrolidin-2-one;hydrate
1-methylpyrrolidin-2-one;hydrate (PubChem CID 22287110) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 1-methylpyrrolidin-2-one;hydrate.
Molecular Properties
| Compound Name | 1-methylpyrrolidin-2-one;hydrate |
| PubChem CID | 22287110 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 1-methylpyrrolidin-2-one;hydrate |
| SMILES | CN1CCCC1=O.O |
| InChI | InChI=1S/C5H9NO.H2O/c1-6-4-2-3-5(6)7;/h2-4H2,1H3;1H2 |
| InChIKey | HCSCWJCZRCSQFA-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methylpyrrolidin-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidin-2-one;hydrate?
The IUPAC name of 1-methylpyrrolidin-2-one;hydrate (CID 22287110) is 1-methylpyrrolidin-2-one;hydrate.
What is the SMILES notation for 1-methylpyrrolidin-2-one;hydrate?
The canonical SMILES for 1-methylpyrrolidin-2-one;hydrate is CN1CCCC1=O.O.
What is the InChIKey of 1-methylpyrrolidin-2-one;hydrate?
The InChIKey is HCSCWJCZRCSQFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.H2O/c1-6-4-2-3-5(6)7;/h2-4H2,1H3;1H2.
What are the key properties of 1-methylpyrrolidin-2-one;hydrate?
1-methylpyrrolidin-2-one;hydrate has a molecular weight of 117.15 g/mol, XLogP of -0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidin-2-one;hydrate is sourced from PubChem (CID 22287110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).