C10H16F6O3Si — CID 22287141
2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propanoic acid (PubChem CID 22287141) has the molecular formula C10H16F6O3Si and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propanoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propanoic acid |
|---|---|
| PubChem CID | 22287141 |
| Molecular Formula | C10H16F6O3Si |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(C(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H16F6O3Si/c1-7(2,3)20(4,5)19-8(6(17)18,9(11,12)13)10(14,15)16/h1-5H3,(H,17,18) |
| InChIKey | DHZDZEOLRPXXOJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|