C11H8ClF3N2O2S — CID 22287402
[3-chloro-4-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]phenyl] thiocyanate (PubChem CID 22287402) has the molecular formula C11H8ClF3N2O2S and a molecular weight of 324.71 g/mol. Its IUPAC name is [3-chloro-4-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]phenyl] thiocyanate.
| Compound Name | [3-chloro-4-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 22287402 |
| Molecular Formula | C11H8ClF3N2O2S |
| Molecular Weight | 324.71 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | [3-chloro-4-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]phenyl] thiocyanate |
| SMILES | CC(O)(C(=O)Nc1ccc(SC#N)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C11H8ClF3N2O2S/c1-10(19,11(13,14)15)9(18)17-8-3-2-6(20-5-16)4-7(8)12/h2-4,19H,1H3,(H,17,18) |
| InChIKey | LYFGOHJOVNQURU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|