About 6-N,6-N-dimethylpyridine-2,6-diamine
6-N,6-N-dimethylpyridine-2,6-diamine (PubChem CID 22287845) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 6-N,6-N-dimethylpyridine-2,6-diamine.
Molecular Properties
| Compound Name | 6-N,6-N-dimethylpyridine-2,6-diamine |
| PubChem CID | 22287845 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 6-N,6-N-dimethylpyridine-2,6-diamine |
| SMILES | CN(C)c1cccc(N)n1 |
| InChI | InChI=1S/C7H11N3/c1-10(2)7-5-3-4-6(8)9-7/h3-5H,1-2H3,(H2,8,9) |
| InChIKey | QFUOHXVQTQKZRB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-N,6-N-dimethylpyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N,6-N-dimethylpyridine-2,6-diamine?
The IUPAC name of 6-N,6-N-dimethylpyridine-2,6-diamine (CID 22287845) is 6-N,6-N-dimethylpyridine-2,6-diamine.
What is the SMILES notation for 6-N,6-N-dimethylpyridine-2,6-diamine?
The canonical SMILES for 6-N,6-N-dimethylpyridine-2,6-diamine is CN(C)c1cccc(N)n1.
What is the InChIKey of 6-N,6-N-dimethylpyridine-2,6-diamine?
The InChIKey is QFUOHXVQTQKZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-10(2)7-5-3-4-6(8)9-7/h3-5H,1-2H3,(H2,8,9).
What are the key properties of 6-N,6-N-dimethylpyridine-2,6-diamine?
6-N,6-N-dimethylpyridine-2,6-diamine has a molecular weight of 137.19 g/mol, XLogP of 0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N,6-N-dimethylpyridine-2,6-diamine is sourced from PubChem (CID 22287845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).