C4H2Cl4F4O — CID 22288049
2,2-dichloro-1-(2,2-dichloro-1,1-difluoroethoxy)-1,1-difluoroethane (PubChem CID 22288049) has the molecular formula C4H2Cl4F4O and a molecular weight of 283.86 g/mol. Its IUPAC name is 2,2-dichloro-1-(2,2-dichloro-1,1-difluoroethoxy)-1,1-difluoroethane.
| Compound Name | 2,2-dichloro-1-(2,2-dichloro-1,1-difluoroethoxy)-1,1-difluoroethane |
|---|---|
| PubChem CID | 22288049 |
| Molecular Formula | C4H2Cl4F4O |
| Molecular Weight | 283.86 g/mol |
| Exact Mass | 281.88 |
| IUPAC Name | 2,2-dichloro-1-(2,2-dichloro-1,1-difluoroethoxy)-1,1-difluoroethane |
| SMILES | FC(F)(OC(F)(F)C(Cl)Cl)C(Cl)Cl |
| InChI | InChI=1S/C4H2Cl4F4O/c5-1(6)3(9,10)13-4(11,12)2(7)8/h1-2H |
| InChIKey | LLSWESFIHBBZME-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|