2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid

C13H18O8 — CID 22289086

IUPAC2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid
SMILESC=C(C(=O)O)C(CC(=O)OCC)(CC(=O)OCC)C(=O)O
InChIInChI=1S/C13H18O8/c1-4-20-9(14)6-13(12(18)19,8(3)11(16)17)7-10(15)21-5-2/h3-7H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyLATAYXXMNYLQLW-UHFFFAOYSA-N
MW302.28 g/mol
LogP0.60
Rot. Bonds9

About 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid

2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid (PubChem CID 22289086) has the molecular formula C13H18O8 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid.

Molecular Properties

Compound Name2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid
PubChem CID22289086
Molecular FormulaC13H18O8
Molecular Weight302.28 g/mol
Exact Mass302.10
IUPAC Name2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid
SMILESC=C(C(=O)O)C(CC(=O)OCC)(CC(=O)OCC)C(=O)O
InChIInChI=1S/C13H18O8/c1-4-20-9(14)6-13(12(18)19,8(3)11(16)17)7-10(15)21-5-2/h3-7H2,1-2H3,(H,16,17)(H,18,19)
InChIKeyLATAYXXMNYLQLW-UHFFFAOYSA-N
XLogP0.60
TPSA127.20 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.28
LogP ≤ 50.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid?
The IUPAC name of 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid (CID 22289086) is 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid.
What is the SMILES notation for 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid?
The canonical SMILES for 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid is C=C(C(=O)O)C(CC(=O)OCC)(CC(=O)OCC)C(=O)O.
What is the InChIKey of 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid?
The InChIKey is LATAYXXMNYLQLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O8/c1-4-20-9(14)6-13(12(18)19,8(3)11(16)17)7-10(15)21-5-2/h3-7H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid?
2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid has a molecular weight of 302.28 g/mol, XLogP of 0.60, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-ethoxy-2-oxoethyl)-3-methylidenebutanedioic acid is sourced from PubChem (CID 22289086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).