C24H46O9 — CID 22290016
1,1-diethoxyethane;tributyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 22290016) has the molecular formula C24H46O9 and a molecular weight of 478.62 g/mol. Its IUPAC name is 1,1-diethoxyethane;tributyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | 1,1-diethoxyethane;tributyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 22290016 |
| Molecular Formula | C24H46O9 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 1,1-diethoxyethane;tributyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC.CCOC(C)OCC |
| InChI | InChI=1S/C18H32O7.C6H14O2/c1-4-7-10-23-15(19)13-18(22,17(21)25-12-9-6-3)14-16(20)24-11-8-5-2;1-4-7-6(3)8-5-2/h22H,4-14H2,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | UMJZVRWPWGWLNJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|