About bicyclo[2.2.1]heptane-2,5,7-triol
bicyclo[2.2.1]heptane-2,5,7-triol (PubChem CID 22290058) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane-2,5,7-triol.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane-2,5,7-triol |
| PubChem CID | 22290058 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | bicyclo[2.2.1]heptane-2,5,7-triol |
| SMILES | OC1CC2C(O)CC1C2O |
| InChI | InChI=1S/C7H12O3/c8-5-1-3-6(9)2-4(5)7(3)10/h3-10H,1-2H2 |
| InChIKey | YMASSALSDPNFHP-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bicyclo[2.2.1]heptane-2,5,7-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane-2,5,7-triol?
The IUPAC name of bicyclo[2.2.1]heptane-2,5,7-triol (CID 22290058) is bicyclo[2.2.1]heptane-2,5,7-triol.
What is the SMILES notation for bicyclo[2.2.1]heptane-2,5,7-triol?
The canonical SMILES for bicyclo[2.2.1]heptane-2,5,7-triol is OC1CC2C(O)CC1C2O.
What is the InChIKey of bicyclo[2.2.1]heptane-2,5,7-triol?
The InChIKey is YMASSALSDPNFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c8-5-1-3-6(9)2-4(5)7(3)10/h3-10H,1-2H2.
What are the key properties of bicyclo[2.2.1]heptane-2,5,7-triol?
bicyclo[2.2.1]heptane-2,5,7-triol has a molecular weight of 144.17 g/mol, XLogP of -0.89, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane-2,5,7-triol is sourced from PubChem (CID 22290058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).