About (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone
(2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone (PubChem CID 22290658) has the molecular formula C21H19NO
and a molecular weight of 301.39 g/mol. Its IUPAC name is (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone.
Molecular Properties
| Compound Name | (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone |
| PubChem CID | 22290658 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone |
| SMILES | C#Cc1ccc2c(c1)CC(C)(C)N/C2=C\C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19NO/c1-4-15-10-11-18-17(12-15)14-21(2,3)22-19(18)13-20(23)16-8-6-5-7-9-16/h1,5-13,22H,14H2,2-3H3/b19-13- |
| InChIKey | FEAZAGMSFYVUIT-UYRXBGFRSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone?
The IUPAC name of (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone (CID 22290658) is (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone.
What is the SMILES notation for (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone?
The canonical SMILES for (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone is C#Cc1ccc2c(c1)CC(C)(C)N/C2=C\C(=O)c1ccccc1.
What is the InChIKey of (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone?
The InChIKey is FEAZAGMSFYVUIT-UYRXBGFRSA-N. The full InChI is InChI=1S/C21H19NO/c1-4-15-10-11-18-17(12-15)14-21(2,3)22-19(18)13-20(23)16-8-6-5-7-9-16/h1,5-13,22H,14H2,2-3H3/b19-13-.
What are the key properties of (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone?
(2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone has a molecular weight of 301.39 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(6-ethynyl-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)-1-phenylethanone is sourced from PubChem (CID 22290658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).